C17H23NO4S — CID 11024204
ethyl (2S)-3-(cyclopenten-1-yl)-2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 11024204) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is ethyl (2S)-3-(cyclopenten-1-yl)-2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | ethyl (2S)-3-(cyclopenten-1-yl)-2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 11024204 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | ethyl (2S)-3-(cyclopenten-1-yl)-2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | CCOC(=O)[C@H](CC1=CCCC1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H23NO4S/c1-3-22-17(19)16(12-14-6-4-5-7-14)18-23(20,21)15-10-8-13(2)9-11-15/h6,8-11,16,18H,3-5,7,12H2,1-2H3/t16-/m0/s1 |
| InChIKey | DHEDOHDSYONONI-INIZCTEOSA-N |
| XLogP | 2.71 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|