C14H23NO5SSi — CID 101187677
ethyl 2-[(4-methylphenyl)sulfonylamino]-2-trimethylsilyloxyacetate (PubChem CID 101187677) has the molecular formula C14H23NO5SSi and a molecular weight of 345.49 g/mol. Its IUPAC name is ethyl 2-[(4-methylphenyl)sulfonylamino]-2-trimethylsilyloxyacetate.
| Compound Name | ethyl 2-[(4-methylphenyl)sulfonylamino]-2-trimethylsilyloxyacetate |
|---|---|
| PubChem CID | 101187677 |
| Molecular Formula | C14H23NO5SSi |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | ethyl 2-[(4-methylphenyl)sulfonylamino]-2-trimethylsilyloxyacetate |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1ccc(C)cc1)O[Si](C)(C)C |
| InChI | InChI=1S/C14H23NO5SSi/c1-6-19-14(16)13(20-22(3,4)5)15-21(17,18)12-9-7-11(2)8-10-12/h7-10,13,15H,6H2,1-5H3 |
| InChIKey | XNXHKOZCFDUVLX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|