C19H31NO4S — CID 11372115
ethyl (3R)-3-[(4-methylphenyl)sulfonylamino]decanoate (PubChem CID 11372115) has the molecular formula C19H31NO4S and a molecular weight of 369.53 g/mol. Its IUPAC name is ethyl (3R)-3-[(4-methylphenyl)sulfonylamino]decanoate.
| Compound Name | ethyl (3R)-3-[(4-methylphenyl)sulfonylamino]decanoate |
|---|---|
| PubChem CID | 11372115 |
| Molecular Formula | C19H31NO4S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | ethyl (3R)-3-[(4-methylphenyl)sulfonylamino]decanoate |
| SMILES | CCCCCCC[C@H](CC(=O)OCC)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H31NO4S/c1-4-6-7-8-9-10-17(15-19(21)24-5-2)20-25(22,23)18-13-11-16(3)12-14-18/h11-14,17,20H,4-10,15H2,1-3H3/t17-/m1/s1 |
| InChIKey | MXSATVMOYROJCD-QGZVFWFLSA-N |
| XLogP | 3.96 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|