C22H32N2O4S2 — CID 101389381
4-methyl-N-[(2R)-2-[(4-methylphenyl)sulfonylamino]octyl]benzenesulfonamide (PubChem CID 101389381) has the molecular formula C22H32N2O4S2 and a molecular weight of 452.64 g/mol. Its IUPAC name is 4-methyl-N-[(2R)-2-[(4-methylphenyl)sulfonylamino]octyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2R)-2-[(4-methylphenyl)sulfonylamino]octyl]benzenesulfonamide |
|---|---|
| PubChem CID | 101389381 |
| Molecular Formula | C22H32N2O4S2 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 4-methyl-N-[(2R)-2-[(4-methylphenyl)sulfonylamino]octyl]benzenesulfonamide |
| SMILES | CCCCCC[C@H](CNS(=O)(=O)c1ccc(C)cc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H32N2O4S2/c1-4-5-6-7-8-20(24-30(27,28)22-15-11-19(3)12-16-22)17-23-29(25,26)21-13-9-18(2)10-14-21/h9-16,20,23-24H,4-8,17H2,1-3H3/t20-/m1/s1 |
| InChIKey | XEHWAYUFMOLIJN-HXUWFJFHSA-N |
| XLogP | 3.90 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|