C23H34BF4NO2S2 — CID 122406829
methyl-(4-methylphenyl)-[(2R)-1-[(4-methylphenyl)sulfonylamino]octan-2-yl]sulfanium tetrafluoroborate (PubChem CID 122406829) has the molecular formula C23H34BF4NO2S2 and a molecular weight of 507.47 g/mol. Its IUPAC name is methyl-(4-methylphenyl)-[(2R)-1-[(4-methylphenyl)sulfonylamino]octan-2-yl]sulfanium tetrafluoroborate.
| Compound Name | methyl-(4-methylphenyl)-[(2R)-1-[(4-methylphenyl)sulfonylamino]octan-2-yl]sulfanium tetrafluoroborate |
|---|---|
| PubChem CID | 122406829 |
| Molecular Formula | C23H34BF4NO2S2 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | methyl-(4-methylphenyl)-[(2R)-1-[(4-methylphenyl)sulfonylamino]octan-2-yl]sulfanium tetrafluoroborate |
| SMILES | CCCCCC[C@H](CNS(=O)(=O)c1ccc(C)cc1)[S+](C)c1ccc(C)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C23H34NO2S2.BF4/c1-5-6-7-8-9-22(27(4)21-14-10-19(2)11-15-21)18-24-28(25,26)23-16-12-20(3)13-17-23;2-1(3,4)5/h10-17,22,24H,5-9,18H2,1-4H3;/q+1;-1/t22-,27?;/m1./s1 |
| InChIKey | WGUZHXSGVMSLIP-POFWCGGFSA-N |
| XLogP | 6.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|