C27H51N2O2S+ — CID 58132126
methyl-[3-[(4-methylphenyl)sulfonylamino]propyl]-dioctylazanium (PubChem CID 58132126) has the molecular formula C27H51N2O2S+ and a molecular weight of 467.78 g/mol. Its IUPAC name is methyl-[3-[(4-methylphenyl)sulfonylamino]propyl]-dioctylazanium.
| Compound Name | methyl-[3-[(4-methylphenyl)sulfonylamino]propyl]-dioctylazanium |
|---|---|
| PubChem CID | 58132126 |
| Molecular Formula | C27H51N2O2S+ |
| Molecular Weight | 467.78 g/mol |
| Exact Mass | 467.37 |
| IUPAC Name | methyl-[3-[(4-methylphenyl)sulfonylamino]propyl]-dioctylazanium |
| SMILES | CCCCCCCC[N+](C)(CCCCCCCC)CCCNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H51N2O2S/c1-5-7-9-11-13-15-23-29(4,24-16-14-12-10-8-6-2)25-17-22-28-32(30,31)27-20-18-26(3)19-21-27/h18-21,28H,5-17,22-25H2,1-4H3/q+1 |
| InChIKey | QBOJLCJRNVEEDL-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.78 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|