C38H74NO3S+ — CID 87344110
4-methylbenzenesulfonic acid;tris-decyl(methyl)azanium (PubChem CID 87344110) has the molecular formula C38H74NO3S+ and a molecular weight of 625.08 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;tris-decyl(methyl)azanium.
| Compound Name | 4-methylbenzenesulfonic acid;tris-decyl(methyl)azanium |
|---|---|
| PubChem CID | 87344110 |
| Molecular Formula | C38H74NO3S+ |
| Molecular Weight | 625.08 g/mol |
| Exact Mass | 624.54 |
| IUPAC Name | 4-methylbenzenesulfonic acid;tris-decyl(methyl)azanium |
| SMILES | CCCCCCCCCC[N+](C)(CCCCCCCCCC)CCCCCCCCCC.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C31H66N.C7H8O3S/c1-5-8-11-14-17-20-23-26-29-32(4,30-27-24-21-18-15-12-9-6-2)31-28-25-22-19-16-13-10-7-3;1-6-2-4-7(5-3-6)11(8,9)10/h5-31H2,1-4H3;2-5H,1H3,(H,8,9,10)/q+1; |
| InChIKey | QBKNLLHGTIIJNT-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.08 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|