About chloro-(4-methylphenyl)sulfonylazanide;methyl(trioctyl)azanium
chloro-(4-methylphenyl)sulfonylazanide;methyl(trioctyl)azanium (PubChem CID 24770373) has the molecular formula C32H61ClN2O2S
and a molecular weight of 573.37 g/mol. Its IUPAC name is chloro-(4-methylphenyl)sulfonylazanide;methyl(trioctyl)azanium.
Molecular Properties
| Compound Name | chloro-(4-methylphenyl)sulfonylazanide;methyl(trioctyl)azanium |
| PubChem CID | 24770373 |
| Molecular Formula | C32H61ClN2O2S |
| Molecular Weight | 573.37 g/mol |
| Exact Mass | 572.41 |
| IUPAC Name | chloro-(4-methylphenyl)sulfonylazanide;methyl(trioctyl)azanium |
| SMILES | CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.Cc1ccc(S(=O)(=O)[N-]Cl)cc1 |
| InChI | InChI=1S/C25H54N.C7H7ClNO2S/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;1-6-2-4-7(5-3-6)12(10,11)9-8/h5-25H2,1-4H3;2-5H,1H3/q+1;-1 |
| InChIKey | GVSIZTIWZLYOEZ-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 573.37 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze chloro-(4-methylphenyl)sulfonylazanide;methyl(trioctyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-(4-methylphenyl)sulfonylazanide;methyl(trioctyl)azanium?
The IUPAC name of chloro-(4-methylphenyl)sulfonylazanide;methyl(trioctyl)azanium (CID 24770373) is chloro-(4-methylphenyl)sulfonylazanide;methyl(trioctyl)azanium.
What is the SMILES notation for chloro-(4-methylphenyl)sulfonylazanide;methyl(trioctyl)azanium?
The canonical SMILES for chloro-(4-methylphenyl)sulfonylazanide;methyl(trioctyl)azanium is CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.Cc1ccc(S(=O)(=O)[N-]Cl)cc1.
What is the InChIKey of chloro-(4-methylphenyl)sulfonylazanide;methyl(trioctyl)azanium?
The InChIKey is GVSIZTIWZLYOEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H54N.C7H7ClNO2S/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;1-6-2-4-7(5-3-6)12(10,11)9-8/h5-25H2,1-4H3;2-5H,1H3/q+1;-1.
What are the key properties of chloro-(4-methylphenyl)sulfonylazanide;methyl(trioctyl)azanium?
chloro-(4-methylphenyl)sulfonylazanide;methyl(trioctyl)azanium has a molecular weight of 573.37 g/mol, XLogP of 10.73, 23 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-(4-methylphenyl)sulfonylazanide;methyl(trioctyl)azanium is sourced from PubChem (CID 24770373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).