C18H27NO2S — CID 78142014
4-methyl-N-undec-1-yn-4-ylbenzenesulfonamide (PubChem CID 78142014) has the molecular formula C18H27NO2S and a molecular weight of 321.49 g/mol. Its IUPAC name is 4-methyl-N-undec-1-yn-4-ylbenzenesulfonamide.
| Compound Name | 4-methyl-N-undec-1-yn-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 78142014 |
| Molecular Formula | C18H27NO2S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 4-methyl-N-undec-1-yn-4-ylbenzenesulfonamide |
| SMILES | C#CCC(CCCCCCC)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H27NO2S/c1-4-6-7-8-9-11-17(10-5-2)19-22(20,21)18-14-12-16(3)13-15-18/h2,12-15,17,19H,4,6-11H2,1,3H3 |
| InChIKey | IRCFGMIWIVSDAJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|