C12H15NO2S — CID 86604885
4-methyl-N-[(2S)-pent-4-yn-2-yl]benzenesulfonamide (PubChem CID 86604885) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 4-methyl-N-[(2S)-pent-4-yn-2-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2S)-pent-4-yn-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 86604885 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 4-methyl-N-[(2S)-pent-4-yn-2-yl]benzenesulfonamide |
| SMILES | C#CC[C@H](C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H15NO2S/c1-4-5-11(3)13-16(14,15)12-8-6-10(2)7-9-12/h1,6-9,11,13H,5H2,2-3H3/t11-/m0/s1 |
| InChIKey | PGUSNHZTOZHCTE-NSHDSACASA-N |
| XLogP | 1.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|