C17H16BrNO2S — CID 154710736
N-[(1R)-1-(2-bromophenyl)but-3-ynyl]-4-methylbenzenesulfonamide (PubChem CID 154710736) has the molecular formula C17H16BrNO2S and a molecular weight of 378.29 g/mol. Its IUPAC name is N-[(1R)-1-(2-bromophenyl)but-3-ynyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R)-1-(2-bromophenyl)but-3-ynyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 154710736 |
| Molecular Formula | C17H16BrNO2S |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | N-[(1R)-1-(2-bromophenyl)but-3-ynyl]-4-methylbenzenesulfonamide |
| SMILES | C#CC[C@@H](NS(=O)(=O)c1ccc(C)cc1)c1ccccc1Br |
| InChI | InChI=1S/C17H16BrNO2S/c1-3-6-17(15-7-4-5-8-16(15)18)19-22(20,21)14-11-9-13(2)10-12-14/h1,4-5,7-12,17,19H,6H2,2H3/t17-/m1/s1 |
| InChIKey | GTSNEEYLYCAQAT-QGZVFWFLSA-N |
| XLogP | 3.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|