C15H16BrNO3S — CID 171590028
N-[1-(2-bromophenyl)-2-hydroxyethyl]-4-methylbenzenesulfonamide (PubChem CID 171590028) has the molecular formula C15H16BrNO3S and a molecular weight of 370.27 g/mol. Its IUPAC name is N-[1-(2-bromophenyl)-2-hydroxyethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-(2-bromophenyl)-2-hydroxyethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 171590028 |
| Molecular Formula | C15H16BrNO3S |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | N-[1-(2-bromophenyl)-2-hydroxyethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CO)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C15H16BrNO3S/c1-11-6-8-12(9-7-11)21(19,20)17-15(10-18)13-4-2-3-5-14(13)16/h2-9,15,17-18H,10H2,1H3 |
| InChIKey | BFOPWOYADJBJMS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |