C19H22BrN3O4S — CID 24544760
N-[1-(2-bromophenyl)ethyl]-2-[[2-[(4-methylphenyl)sulfonylamino]acetyl]amino]acetamide (PubChem CID 24544760) has the molecular formula C19H22BrN3O4S and a molecular weight of 468.37 g/mol. Its IUPAC name is N-[1-(2-bromophenyl)ethyl]-2-[[2-[(4-methylphenyl)sulfonylamino]acetyl]amino]acetamide.
| Compound Name | N-[1-(2-bromophenyl)ethyl]-2-[[2-[(4-methylphenyl)sulfonylamino]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 24544760 |
| Molecular Formula | C19H22BrN3O4S |
| Molecular Weight | 468.37 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | N-[1-(2-bromophenyl)ethyl]-2-[[2-[(4-methylphenyl)sulfonylamino]acetyl]amino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)NCC(=O)NC(C)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C19H22BrN3O4S/c1-13-7-9-15(10-8-13)28(26,27)22-12-18(24)21-11-19(25)23-14(2)16-5-3-4-6-17(16)20/h3-10,14,22H,11-12H2,1-2H3,(H,21,24)(H,23,25) |
| InChIKey | XHPMQJIZBBHDBU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |