C15H22BrN3O2 — CID 82963456
(2S)-2-amino-N-[2-[1-(2-bromophenyl)ethylamino]-2-oxoethyl]-3-methylbutanamide (PubChem CID 82963456) has the molecular formula C15H22BrN3O2 and a molecular weight of 356.26 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-[1-(2-bromophenyl)ethylamino]-2-oxoethyl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-[1-(2-bromophenyl)ethylamino]-2-oxoethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 82963456 |
| Molecular Formula | C15H22BrN3O2 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (2S)-2-amino-N-[2-[1-(2-bromophenyl)ethylamino]-2-oxoethyl]-3-methylbutanamide |
| SMILES | CC(NC(=O)CNC(=O)[C@@H](N)C(C)C)c1ccccc1Br |
| InChI | InChI=1S/C15H22BrN3O2/c1-9(2)14(17)15(21)18-8-13(20)19-10(3)11-6-4-5-7-12(11)16/h4-7,9-10,14H,8,17H2,1-3H3,(H,18,21)(H,19,20)/t10?,14-/m0/s1 |
| InChIKey | HYYIRFYOOYBRHI-SBNLOKMTSA-N |
| XLogP | 1.73 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |