C16H25BrN2O — CID 104867337
3-amino-N-[(1R)-1-(2-bromophenyl)ethyl]-5,5-dimethylhexanamide (PubChem CID 104867337) has the molecular formula C16H25BrN2O and a molecular weight of 341.29 g/mol. Its IUPAC name is 3-amino-N-[(1R)-1-(2-bromophenyl)ethyl]-5,5-dimethylhexanamide.
| Compound Name | 3-amino-N-[(1R)-1-(2-bromophenyl)ethyl]-5,5-dimethylhexanamide |
|---|---|
| PubChem CID | 104867337 |
| Molecular Formula | C16H25BrN2O |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-amino-N-[(1R)-1-(2-bromophenyl)ethyl]-5,5-dimethylhexanamide |
| SMILES | C[C@@H](NC(=O)CC(N)CC(C)(C)C)c1ccccc1Br |
| InChI | InChI=1S/C16H25BrN2O/c1-11(13-7-5-6-8-14(13)17)19-15(20)9-12(18)10-16(2,3)4/h5-8,11-12H,9-10,18H2,1-4H3,(H,19,20)/t11-,12?/m1/s1 |
| InChIKey | MVQYRNJSOZCGTM-JHJMLUEUSA-N |
| XLogP | 3.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |