C16H25BrN2O — CID 81383775
6-amino-N-[(1R)-1-(2-bromophenyl)ethyl]-4,4-dimethylhexanamide (PubChem CID 81383775) has the molecular formula C16H25BrN2O and a molecular weight of 341.29 g/mol. Its IUPAC name is 6-amino-N-[(1R)-1-(2-bromophenyl)ethyl]-4,4-dimethylhexanamide.
| Compound Name | 6-amino-N-[(1R)-1-(2-bromophenyl)ethyl]-4,4-dimethylhexanamide |
|---|---|
| PubChem CID | 81383775 |
| Molecular Formula | C16H25BrN2O |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 6-amino-N-[(1R)-1-(2-bromophenyl)ethyl]-4,4-dimethylhexanamide |
| SMILES | C[C@@H](NC(=O)CCC(C)(C)CCN)c1ccccc1Br |
| InChI | InChI=1S/C16H25BrN2O/c1-12(13-6-4-5-7-14(13)17)19-15(20)8-9-16(2,3)10-11-18/h4-7,12H,8-11,18H2,1-3H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | LJGDIIBMMDGQDD-GFCCVEGCSA-N |
| XLogP | 3.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |