C17H18BrFN2O3S — CID 51644297
N-[(1R)-1-(2-bromophenyl)ethyl]-3-[(4-fluorophenyl)sulfonylamino]propanamide (PubChem CID 51644297) has the molecular formula C17H18BrFN2O3S and a molecular weight of 429.31 g/mol. Its IUPAC name is N-[(1R)-1-(2-bromophenyl)ethyl]-3-[(4-fluorophenyl)sulfonylamino]propanamide.
| Compound Name | N-[(1R)-1-(2-bromophenyl)ethyl]-3-[(4-fluorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 51644297 |
| Molecular Formula | C17H18BrFN2O3S |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | N-[(1R)-1-(2-bromophenyl)ethyl]-3-[(4-fluorophenyl)sulfonylamino]propanamide |
| SMILES | C[C@@H](NC(=O)CCNS(=O)(=O)c1ccc(F)cc1)c1ccccc1Br |
| InChI | InChI=1S/C17H18BrFN2O3S/c1-12(15-4-2-3-5-16(15)18)21-17(22)10-11-20-25(23,24)14-8-6-13(19)7-9-14/h2-9,12,20H,10-11H2,1H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | AHECYGPZKJSNMC-GFCCVEGCSA-N |
| XLogP | 3.13 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |