C12H14BrN — CID 62234979
1-(2-bromophenyl)-N-ethylbut-3-yn-1-amine (PubChem CID 62234979) has the molecular formula C12H14BrN and a molecular weight of 252.15 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-ethylbut-3-yn-1-amine.
| Compound Name | 1-(2-bromophenyl)-N-ethylbut-3-yn-1-amine |
|---|---|
| PubChem CID | 62234979 |
| Molecular Formula | C12H14BrN |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 1-(2-bromophenyl)-N-ethylbut-3-yn-1-amine |
| SMILES | C#CCC(NCC)c1ccccc1Br |
| InChI | InChI=1S/C12H14BrN/c1-3-7-12(14-4-2)10-8-5-6-9-11(10)13/h1,5-6,8-9,12,14H,4,7H2,2H3 |
| InChIKey | GNRCYNOZEPBLFV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|