C16H26BrN — CID 114209930
1-(2-bromophenyl)-N-ethyl-5,5-dimethylhexan-1-amine (PubChem CID 114209930) has the molecular formula C16H26BrN and a molecular weight of 312.29 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-ethyl-5,5-dimethylhexan-1-amine.
| Compound Name | 1-(2-bromophenyl)-N-ethyl-5,5-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 114209930 |
| Molecular Formula | C16H26BrN |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-(2-bromophenyl)-N-ethyl-5,5-dimethylhexan-1-amine |
| SMILES | CCNC(CCCC(C)(C)C)c1ccccc1Br |
| InChI | InChI=1S/C16H26BrN/c1-5-18-15(11-8-12-16(2,3)4)13-9-6-7-10-14(13)17/h6-7,9-10,15,18H,5,8,11-12H2,1-4H3 |
| InChIKey | IEHIZUBVVSFMGB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |