C13H16Br2F3N — CID 107946545
1-(2,4-dibromophenyl)-N-ethyl-5,5,5-trifluoropentan-1-amine (PubChem CID 107946545) has the molecular formula C13H16Br2F3N and a molecular weight of 403.08 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-N-ethyl-5,5,5-trifluoropentan-1-amine.
| Compound Name | 1-(2,4-dibromophenyl)-N-ethyl-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 107946545 |
| Molecular Formula | C13H16Br2F3N |
| Molecular Weight | 403.08 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | 1-(2,4-dibromophenyl)-N-ethyl-5,5,5-trifluoropentan-1-amine |
| SMILES | CCNC(CCCC(F)(F)F)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H16Br2F3N/c1-2-19-12(4-3-7-13(16,17)18)10-6-5-9(14)8-11(10)15/h5-6,8,12,19H,2-4,7H2,1H3 |
| InChIKey | KZGRFLILSCBUQJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.08 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |