C16H25Br2N — CID 107945392
1-(2,4-dibromophenyl)-N-propylheptan-1-amine (PubChem CID 107945392) has the molecular formula C16H25Br2N and a molecular weight of 391.19 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-N-propylheptan-1-amine.
| Compound Name | 1-(2,4-dibromophenyl)-N-propylheptan-1-amine |
|---|---|
| PubChem CID | 107945392 |
| Molecular Formula | C16H25Br2N |
| Molecular Weight | 391.19 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 1-(2,4-dibromophenyl)-N-propylheptan-1-amine |
| SMILES | CCCCCCC(NCCC)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H25Br2N/c1-3-5-6-7-8-16(19-11-4-2)14-10-9-13(17)12-15(14)18/h9-10,12,16,19H,3-8,11H2,1-2H3 |
| InChIKey | IEAIMWFHMZYNNZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.19 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|