C15H23Br2NO2S — CID 115865316
1-(2,5-dibromophenyl)-4-ethylsulfonyl-N-propylbutan-1-amine (PubChem CID 115865316) has the molecular formula C15H23Br2NO2S and a molecular weight of 441.23 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-4-ethylsulfonyl-N-propylbutan-1-amine.
| Compound Name | 1-(2,5-dibromophenyl)-4-ethylsulfonyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 115865316 |
| Molecular Formula | C15H23Br2NO2S |
| Molecular Weight | 441.23 g/mol |
| Exact Mass | 438.98 |
| IUPAC Name | 1-(2,5-dibromophenyl)-4-ethylsulfonyl-N-propylbutan-1-amine |
| SMILES | CCCNC(CCCS(=O)(=O)CC)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C15H23Br2NO2S/c1-3-9-18-15(6-5-10-21(19,20)4-2)13-11-12(16)7-8-14(13)17/h7-8,11,15,18H,3-6,9-10H2,1-2H3 |
| InChIKey | DQRSPCAYYPUICL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.23 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |