C14H22BrNO2S — CID 115820342
1-(5-bromo-2-methylphenyl)-N-ethyl-4-methylsulfonylbutan-1-amine (PubChem CID 115820342) has the molecular formula C14H22BrNO2S and a molecular weight of 348.31 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenyl)-N-ethyl-4-methylsulfonylbutan-1-amine.
| Compound Name | 1-(5-bromo-2-methylphenyl)-N-ethyl-4-methylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 115820342 |
| Molecular Formula | C14H22BrNO2S |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 1-(5-bromo-2-methylphenyl)-N-ethyl-4-methylsulfonylbutan-1-amine |
| SMILES | CCNC(CCCS(C)(=O)=O)c1cc(Br)ccc1C |
| InChI | InChI=1S/C14H22BrNO2S/c1-4-16-14(6-5-9-19(3,17)18)13-10-12(15)8-7-11(13)2/h7-8,10,14,16H,4-6,9H2,1-3H3 |
| InChIKey | XEJKHDFRUBMTEA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |