C12H17Br2NO2S — CID 114019233
1-(2,4-dibromophenyl)-N-methyl-4-methylsulfonylbutan-1-amine (PubChem CID 114019233) has the molecular formula C12H17Br2NO2S and a molecular weight of 399.15 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-N-methyl-4-methylsulfonylbutan-1-amine.
| Compound Name | 1-(2,4-dibromophenyl)-N-methyl-4-methylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 114019233 |
| Molecular Formula | C12H17Br2NO2S |
| Molecular Weight | 399.15 g/mol |
| Exact Mass | 396.93 |
| IUPAC Name | 1-(2,4-dibromophenyl)-N-methyl-4-methylsulfonylbutan-1-amine |
| SMILES | CNC(CCCS(C)(=O)=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H17Br2NO2S/c1-15-12(4-3-7-18(2,16)17)10-6-5-9(13)8-11(10)14/h5-6,8,12,15H,3-4,7H2,1-2H3 |
| InChIKey | UPGYFAHJMDMZPS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.15 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |