C14H21Br2N — CID 107945526
1-(2,4-dibromophenyl)-N,3-dimethylhexan-1-amine (PubChem CID 107945526) has the molecular formula C14H21Br2N and a molecular weight of 363.14 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-N,3-dimethylhexan-1-amine.
| Compound Name | 1-(2,4-dibromophenyl)-N,3-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 107945526 |
| Molecular Formula | C14H21Br2N |
| Molecular Weight | 363.14 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 1-(2,4-dibromophenyl)-N,3-dimethylhexan-1-amine |
| SMILES | CCCC(C)CC(NC)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H21Br2N/c1-4-5-10(2)8-14(17-3)12-7-6-11(15)9-13(12)16/h6-7,9-10,14,17H,4-5,8H2,1-3H3 |
| InChIKey | YPFKZMOHJPCKIM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.14 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |