C13H21NO2S — CID 63192498
N-methyl-1-(2-methylphenyl)-4-methylsulfonylbutan-1-amine (PubChem CID 63192498) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is N-methyl-1-(2-methylphenyl)-4-methylsulfonylbutan-1-amine.
| Compound Name | N-methyl-1-(2-methylphenyl)-4-methylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 63192498 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N-methyl-1-(2-methylphenyl)-4-methylsulfonylbutan-1-amine |
| SMILES | CNC(CCCS(C)(=O)=O)c1ccccc1C |
| InChI | InChI=1S/C13H21NO2S/c1-11-7-4-5-8-12(11)13(14-2)9-6-10-17(3,15)16/h4-5,7-8,13-14H,6,9-10H2,1-3H3 |
| InChIKey | BQPMHNIFKYICTR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |