C15H24ClNO2S — CID 115820969
1-(2-chloro-3-methylphenyl)-4-methylsulfonyl-N-propylbutan-1-amine (PubChem CID 115820969) has the molecular formula C15H24ClNO2S and a molecular weight of 317.88 g/mol. Its IUPAC name is 1-(2-chloro-3-methylphenyl)-4-methylsulfonyl-N-propylbutan-1-amine.
| Compound Name | 1-(2-chloro-3-methylphenyl)-4-methylsulfonyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 115820969 |
| Molecular Formula | C15H24ClNO2S |
| Molecular Weight | 317.88 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-(2-chloro-3-methylphenyl)-4-methylsulfonyl-N-propylbutan-1-amine |
| SMILES | CCCNC(CCCS(C)(=O)=O)c1cccc(C)c1Cl |
| InChI | InChI=1S/C15H24ClNO2S/c1-4-10-17-14(9-6-11-20(3,18)19)13-8-5-7-12(2)15(13)16/h5,7-8,14,17H,4,6,9-11H2,1-3H3 |
| InChIKey | YHHOXIXWLHAPTR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.88 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |