C14H21Cl2NO2S — CID 115820918
1-(3,5-dichlorophenyl)-4-methylsulfonyl-N-propylbutan-1-amine (PubChem CID 115820918) has the molecular formula C14H21Cl2NO2S and a molecular weight of 338.30 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-4-methylsulfonyl-N-propylbutan-1-amine.
| Compound Name | 1-(3,5-dichlorophenyl)-4-methylsulfonyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 115820918 |
| Molecular Formula | C14H21Cl2NO2S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-4-methylsulfonyl-N-propylbutan-1-amine |
| SMILES | CCCNC(CCCS(C)(=O)=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H21Cl2NO2S/c1-3-6-17-14(5-4-7-20(2,18)19)11-8-12(15)10-13(16)9-11/h8-10,14,17H,3-7H2,1-2H3 |
| InChIKey | FNLOMGJDCFMOBQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |