C13H19F2NO2S — CID 62601882
1-(3,4-difluorophenyl)-3-methylsulfonyl-N-propylpropan-1-amine (PubChem CID 62601882) has the molecular formula C13H19F2NO2S and a molecular weight of 291.36 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-methylsulfonyl-N-propylpropan-1-amine.
| Compound Name | 1-(3,4-difluorophenyl)-3-methylsulfonyl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 62601882 |
| Molecular Formula | C13H19F2NO2S |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-methylsulfonyl-N-propylpropan-1-amine |
| SMILES | CCCNC(CCS(C)(=O)=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H19F2NO2S/c1-3-7-16-13(6-8-19(2,17)18)10-4-5-11(14)12(15)9-10/h4-5,9,13,16H,3,6-8H2,1-2H3 |
| InChIKey | HISQOTVQRVNYTO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |