C14H21ClINO2S — CID 103214795
1-(3-chloro-4-iodophenyl)-4-methylsulfonyl-N-propylbutan-1-amine (PubChem CID 103214795) has the molecular formula C14H21ClINO2S and a molecular weight of 429.75 g/mol. Its IUPAC name is 1-(3-chloro-4-iodophenyl)-4-methylsulfonyl-N-propylbutan-1-amine.
| Compound Name | 1-(3-chloro-4-iodophenyl)-4-methylsulfonyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 103214795 |
| Molecular Formula | C14H21ClINO2S |
| Molecular Weight | 429.75 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | 1-(3-chloro-4-iodophenyl)-4-methylsulfonyl-N-propylbutan-1-amine |
| SMILES | CCCNC(CCCS(C)(=O)=O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C14H21ClINO2S/c1-3-8-17-14(5-4-9-20(2,18)19)11-6-7-13(16)12(15)10-11/h6-7,10,14,17H,3-5,8-9H2,1-2H3 |
| InChIKey | NMZVEFWBACNWFF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.75 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|