C17H19ClIN — CID 103214524
N-[1-(3-chloro-4-iodophenyl)-2-phenylethyl]propan-1-amine (PubChem CID 103214524) has the molecular formula C17H19ClIN and a molecular weight of 399.70 g/mol. Its IUPAC name is N-[1-(3-chloro-4-iodophenyl)-2-phenylethyl]propan-1-amine.
| Compound Name | N-[1-(3-chloro-4-iodophenyl)-2-phenylethyl]propan-1-amine |
|---|---|
| PubChem CID | 103214524 |
| Molecular Formula | C17H19ClIN |
| Molecular Weight | 399.70 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | N-[1-(3-chloro-4-iodophenyl)-2-phenylethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccccc1)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C17H19ClIN/c1-2-10-20-17(11-13-6-4-3-5-7-13)14-8-9-16(19)15(18)12-14/h3-9,12,17,20H,2,10-11H2,1H3 |
| InChIKey | AFDSPCHLHKCUNS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.70 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|