C17H21N — CID 36689865
N-[(1S)-1,2-diphenylethyl]propan-1-amine (PubChem CID 36689865) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is N-[(1S)-1,2-diphenylethyl]propan-1-amine.
| Compound Name | N-[(1S)-1,2-diphenylethyl]propan-1-amine |
|---|---|
| PubChem CID | 36689865 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N-[(1S)-1,2-diphenylethyl]propan-1-amine |
| SMILES | CCCN[C@@H](Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H21N/c1-2-13-18-17(16-11-7-4-8-12-16)14-15-9-5-3-6-10-15/h3-12,17-18H,2,13-14H2,1H3/t17-/m0/s1 |
| InChIKey | QDJKYFSVYJISOP-KRWDZBQOSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |