C16H22Cl2N2 — CID 70443145
N'-(1,2-diphenylethyl)ethane-1,2-diamine;dihydrochloride (PubChem CID 70443145) has the molecular formula C16H22Cl2N2 and a molecular weight of 313.27 g/mol. Its IUPAC name is N'-(1,2-diphenylethyl)ethane-1,2-diamine;dihydrochloride.
| Compound Name | N'-(1,2-diphenylethyl)ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 70443145 |
| Molecular Formula | C16H22Cl2N2 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N'-(1,2-diphenylethyl)ethane-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.NCCNC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H20N2.2ClH/c17-11-12-18-16(15-9-5-2-6-10-15)13-14-7-3-1-4-8-14;;/h1-10,16,18H,11-13,17H2;2*1H |
| InChIKey | JERKHHQRWPUMDT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |