C17H21NO3S — CID 15086169
3-(1,2-diphenylethylamino)propane-1-sulfonic acid (PubChem CID 15086169) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 3-(1,2-diphenylethylamino)propane-1-sulfonic acid.
| Compound Name | 3-(1,2-diphenylethylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 15086169 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-(1,2-diphenylethylamino)propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H21NO3S/c19-22(20,21)13-7-12-18-17(16-10-5-2-6-11-16)14-15-8-3-1-4-9-15/h1-6,8-11,17-18H,7,12-14H2,(H,19,20,21) |
| InChIKey | YMZZHFRYPKCINN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|