C13H19NO4S2 — CID 15120721
3-[(2-benzyl-3-sulfanylpropanoyl)amino]propane-1-sulfonic acid (PubChem CID 15120721) has the molecular formula C13H19NO4S2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 3-[(2-benzyl-3-sulfanylpropanoyl)amino]propane-1-sulfonic acid.
| Compound Name | 3-[(2-benzyl-3-sulfanylpropanoyl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 15120721 |
| Molecular Formula | C13H19NO4S2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 3-[(2-benzyl-3-sulfanylpropanoyl)amino]propane-1-sulfonic acid |
| SMILES | O=C(NCCCS(=O)(=O)O)C(CS)Cc1ccccc1 |
| InChI | InChI=1S/C13H19NO4S2/c15-13(14-7-4-8-20(16,17)18)12(10-19)9-11-5-2-1-3-6-11/h1-3,5-6,12,19H,4,7-10H2,(H,14,15)(H,16,17,18) |
| InChIKey | XGPPYALUBWOGLG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|