C10H14N2O4S — CID 88585167
3-(phenylcarbamoylamino)propane-1-sulfonic acid (PubChem CID 88585167) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 3-(phenylcarbamoylamino)propane-1-sulfonic acid.
| Compound Name | 3-(phenylcarbamoylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 88585167 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3-(phenylcarbamoylamino)propane-1-sulfonic acid |
| SMILES | O=C(NCCCS(=O)(=O)O)Nc1ccccc1 |
| InChI | InChI=1S/C10H14N2O4S/c13-10(11-7-4-8-17(14,15)16)12-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H2,11,12,13)(H,14,15,16) |
| InChIKey | NTLWQXGKSWPMRE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|