C13H19N3O — CID 70507693
1-phenyl-3-[3-(prop-1-enylamino)propyl]urea (PubChem CID 70507693) has the molecular formula C13H19N3O and a molecular weight of 233.32 g/mol. Its IUPAC name is 1-phenyl-3-[3-(prop-1-enylamino)propyl]urea.
| Compound Name | 1-phenyl-3-[3-(prop-1-enylamino)propyl]urea |
|---|---|
| PubChem CID | 70507693 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 1-phenyl-3-[3-(prop-1-enylamino)propyl]urea |
| SMILES | CC=CNCCCNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C13H19N3O/c1-2-9-14-10-6-11-15-13(17)16-12-7-4-3-5-8-12/h2-5,7-9,14H,6,10-11H2,1H3,(H2,15,16,17) |
| InChIKey | ISVJHUYBYLHMOE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|