C12H17ClN2OS — CID 87670182
(2S)-N-(2-aminoethyl)-2-[(3-chlorophenyl)methyl]-3-sulfanylpropanamide (PubChem CID 87670182) has the molecular formula C12H17ClN2OS and a molecular weight of 272.80 g/mol. Its IUPAC name is (2S)-N-(2-aminoethyl)-2-[(3-chlorophenyl)methyl]-3-sulfanylpropanamide.
| Compound Name | (2S)-N-(2-aminoethyl)-2-[(3-chlorophenyl)methyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 87670182 |
| Molecular Formula | C12H17ClN2OS |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (2S)-N-(2-aminoethyl)-2-[(3-chlorophenyl)methyl]-3-sulfanylpropanamide |
| SMILES | NCCNC(=O)[C@@H](CS)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H17ClN2OS/c13-11-3-1-2-9(7-11)6-10(8-17)12(16)15-5-4-14/h1-3,7,10,17H,4-6,8,14H2,(H,15,16)/t10-/m1/s1 |
| InChIKey | HSVMZAKEBVRRAI-SNVBAGLBSA-N |
| XLogP | 1.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|