C12H17ClN2O — CID 80542146
4-amino-N-[(3-chlorophenyl)methyl]-2-methylbutanamide (PubChem CID 80542146) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 4-amino-N-[(3-chlorophenyl)methyl]-2-methylbutanamide.
| Compound Name | 4-amino-N-[(3-chlorophenyl)methyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 80542146 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-amino-N-[(3-chlorophenyl)methyl]-2-methylbutanamide |
| SMILES | CC(CCN)C(=O)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H17ClN2O/c1-9(5-6-14)12(16)15-8-10-3-2-4-11(13)7-10/h2-4,7,9H,5-6,8,14H2,1H3,(H,15,16) |
| InChIKey | AYDSBDXZEIXBHN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |