C13H18ClN3O2 — CID 76946155
N-[(3-chlorophenyl)methyl]-2-(N'-hydroxycarbamimidoyl)-3-methylbutanamide (PubChem CID 76946155) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-(N'-hydroxycarbamimidoyl)-3-methylbutanamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-(N'-hydroxycarbamimidoyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 76946155 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-(N'-hydroxycarbamimidoyl)-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)NCc1cccc(Cl)c1)C(N)=NO |
| InChI | InChI=1S/C13H18ClN3O2/c1-8(2)11(12(15)17-19)13(18)16-7-9-4-3-5-10(14)6-9/h3-6,8,11,19H,7H2,1-2H3,(H2,15,17)(H,16,18) |
| InChIKey | SYGGKNNGSQWTAH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|