C15H21NO5S2 — CID 15120666
3-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]propane-1-sulfonic acid (PubChem CID 15120666) has the molecular formula C15H21NO5S2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 3-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 15120666 |
| Molecular Formula | C15H21NO5S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 3-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]propane-1-sulfonic acid |
| SMILES | CC(=O)SCC(Cc1ccccc1)C(=O)NCCCS(=O)(=O)O |
| InChI | InChI=1S/C15H21NO5S2/c1-12(17)22-11-14(10-13-6-3-2-4-7-13)15(18)16-8-5-9-23(19,20)21/h2-4,6-7,14H,5,8-11H2,1H3,(H,16,18)(H,19,20,21) |
| InChIKey | YSFSQGKSJJNVRH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|