C27H27NO4S — CID 87951997
(2S)-2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]-3,3-diphenylpropanoic acid (PubChem CID 87951997) has the molecular formula C27H27NO4S and a molecular weight of 461.58 g/mol. Its IUPAC name is (2S)-2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]-3,3-diphenylpropanoic acid.
| Compound Name | (2S)-2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]-3,3-diphenylpropanoic acid |
|---|---|
| PubChem CID | 87951997 |
| Molecular Formula | C27H27NO4S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | (2S)-2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]-3,3-diphenylpropanoic acid |
| SMILES | CC(=O)SCC(Cc1ccccc1)C(=O)N[C@H](C(=O)O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H27NO4S/c1-19(29)33-18-23(17-20-11-5-2-6-12-20)26(30)28-25(27(31)32)24(21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,23-25H,17-18H2,1H3,(H,28,30)(H,31,32)/t23?,25-/m0/s1 |
| InChIKey | IKUIRYFEKGGYMR-YNMFNDETSA-N |
| XLogP | 4.53 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|