C17H23NO4S3 — CID 88519225
(2R)-2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]-3-(methylsulfanylmethylsulfanyl)propanoic acid (PubChem CID 88519225) has the molecular formula C17H23NO4S3 and a molecular weight of 401.58 g/mol. Its IUPAC name is (2R)-2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]-3-(methylsulfanylmethylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]-3-(methylsulfanylmethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 88519225 |
| Molecular Formula | C17H23NO4S3 |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | (2R)-2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]-3-(methylsulfanylmethylsulfanyl)propanoic acid |
| SMILES | CSCSC[C@H](NC(=O)C(CSC(C)=O)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H23NO4S3/c1-12(19)25-9-14(8-13-6-4-3-5-7-13)16(20)18-15(17(21)22)10-24-11-23-2/h3-7,14-15H,8-11H2,1-2H3,(H,18,20)(H,21,22)/t14?,15-/m0/s1 |
| InChIKey | NRVWSXIHJCAHIX-LOACHALJSA-N |
| XLogP | 2.75 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|