C18H25NO4S2 — CID 14770780
2-[[2-(acetylsulfanylmethyl)-3-(2-methylphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 14770780) has the molecular formula C18H25NO4S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 2-[[2-(acetylsulfanylmethyl)-3-(2-methylphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-(acetylsulfanylmethyl)-3-(2-methylphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 14770780 |
| Molecular Formula | C18H25NO4S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-[[2-(acetylsulfanylmethyl)-3-(2-methylphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(CSC(C)=O)Cc1ccccc1C)C(=O)O |
| InChI | InChI=1S/C18H25NO4S2/c1-12-6-4-5-7-14(12)10-15(11-25-13(2)20)17(21)19-16(18(22)23)8-9-24-3/h4-7,15-16H,8-11H2,1-3H3,(H,19,21)(H,22,23) |
| InChIKey | SJTLQPVWUJMDNP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|