C20H29NO4S2 — CID 10251085
ethyl (2S)-2-[[(2R)-2-(acetylsulfanylmethyl)-4-phenylbutanoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 10251085) has the molecular formula C20H29NO4S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2R)-2-(acetylsulfanylmethyl)-4-phenylbutanoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | ethyl (2S)-2-[[(2R)-2-(acetylsulfanylmethyl)-4-phenylbutanoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 10251085 |
| Molecular Formula | C20H29NO4S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | ethyl (2S)-2-[[(2R)-2-(acetylsulfanylmethyl)-4-phenylbutanoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CCOC(=O)[C@H](CCSC)NC(=O)[C@@H](CCc1ccccc1)CSC(C)=O |
| InChI | InChI=1S/C20H29NO4S2/c1-4-25-20(24)18(12-13-26-3)21-19(23)17(14-27-15(2)22)11-10-16-8-6-5-7-9-16/h5-9,17-18H,4,10-14H2,1-3H3,(H,21,23)/t17-,18-/m0/s1 |
| InChIKey | PJQRNEZRCBAHCB-ROUUACIJSA-N |
| XLogP | 3.32 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|