C17H26N2O3S — CID 3849240
methyl 4-methylsulfanyl-2-(4-phenylbutan-2-ylcarbamoylamino)butanoate (PubChem CID 3849240) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is methyl 4-methylsulfanyl-2-(4-phenylbutan-2-ylcarbamoylamino)butanoate.
| Compound Name | methyl 4-methylsulfanyl-2-(4-phenylbutan-2-ylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 3849240 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | methyl 4-methylsulfanyl-2-(4-phenylbutan-2-ylcarbamoylamino)butanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)NC(C)CCc1ccccc1 |
| InChI | InChI=1S/C17H26N2O3S/c1-13(9-10-14-7-5-4-6-8-14)18-17(21)19-15(11-12-23-3)16(20)22-2/h4-8,13,15H,9-12H2,1-3H3,(H2,18,19,21) |
| InChIKey | WTEFTFLGKQIRAL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |