C21H31N3O7S — CID 50913869
(2S)-2-[[(2S)-1-methoxy-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 50913869) has the molecular formula C21H31N3O7S and a molecular weight of 469.56 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-methoxy-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-methoxy-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 50913869 |
| Molecular Formula | C21H31N3O7S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (2S)-2-[[(2S)-1-methoxy-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)N[C@@H](CCSC)C(=O)O |
| InChI | InChI=1S/C21H31N3O7S/c1-30-19(27)17(24-20(28)23-16(18(25)26)11-13-32-2)10-6-7-12-22-21(29)31-14-15-8-4-3-5-9-15/h3-5,8-9,16-17H,6-7,10-14H2,1-2H3,(H,22,29)(H,25,26)(H2,23,24,28)/t16-,17-/m0/s1 |
| InChIKey | NYBOJWHHTXVWAP-IRXDYDNUSA-N |
| XLogP | 2.13 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|