C17H25NO3S2 — CID 22827167
ethyl (2S)-2-(3-benzylsulfanylpropanoylamino)-4-methylsulfanylbutanoate (PubChem CID 22827167) has the molecular formula C17H25NO3S2 and a molecular weight of 355.53 g/mol. Its IUPAC name is ethyl (2S)-2-(3-benzylsulfanylpropanoylamino)-4-methylsulfanylbutanoate.
| Compound Name | ethyl (2S)-2-(3-benzylsulfanylpropanoylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 22827167 |
| Molecular Formula | C17H25NO3S2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | ethyl (2S)-2-(3-benzylsulfanylpropanoylamino)-4-methylsulfanylbutanoate |
| SMILES | CCOC(=O)[C@H](CCSC)NC(=O)CCSCc1ccccc1 |
| InChI | InChI=1S/C17H25NO3S2/c1-3-21-17(20)15(9-11-22-2)18-16(19)10-12-23-13-14-7-5-4-6-8-14/h4-8,15H,3,9-13H2,1-2H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | HBUHWXVWXCRCRQ-HNNXBMFYSA-N |
| XLogP | 3.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|