C14H19NO3S2 — CID 43091792
2-[(2-benzylsulfanylacetyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 43091792) has the molecular formula C14H19NO3S2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 2-[(2-benzylsulfanylacetyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(2-benzylsulfanylacetyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 43091792 |
| Molecular Formula | C14H19NO3S2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-[(2-benzylsulfanylacetyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)CSCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H19NO3S2/c1-19-8-7-12(14(17)18)15-13(16)10-20-9-11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | LOXQRAHHYGNOPX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |