C13H17NO3S2 — CID 114212579
2-[(2-benzylsulfanylacetyl)amino]-4-sulfanylbutanoic acid (PubChem CID 114212579) has the molecular formula C13H17NO3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-[(2-benzylsulfanylacetyl)amino]-4-sulfanylbutanoic acid.
| Compound Name | 2-[(2-benzylsulfanylacetyl)amino]-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 114212579 |
| Molecular Formula | C13H17NO3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-[(2-benzylsulfanylacetyl)amino]-4-sulfanylbutanoic acid |
| SMILES | O=C(CSCc1ccccc1)NC(CCS)C(=O)O |
| InChI | InChI=1S/C13H17NO3S2/c15-12(14-11(6-7-18)13(16)17)9-19-8-10-4-2-1-3-5-10/h1-5,11,18H,6-9H2,(H,14,15)(H,16,17) |
| InChIKey | STVCJOVFASGBSW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|